C15H28N4O3S — CID 118372186
2-[(2R,3R,4R)-4-(dimethylamino)-3-hydroxy-2-methyl-5-(methylamino)-5-oxopentyl]-N,N-dimethyl-4,5-dihydro-1,3-thiazole-4-carboxamide (PubChem CID 118372186) has the molecular formula C15H28N4O3S and a molecular weight of 344.48 g/mol. Its IUPAC name is 2-[(2R,3R,4R)-4-(dimethylamino)-3-hydroxy-2-methyl-5-(methylamino)-5-oxopentyl]-N,N-dimethyl-4,5-dihydro-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(2R,3R,4R)-4-(dimethylamino)-3-hydroxy-2-methyl-5-(methylamino)-5-oxopentyl]-N,N-dimethyl-4,5-dihydro-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 118372186 |
| Molecular Formula | C15H28N4O3S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 2-[(2R,3R,4R)-4-(dimethylamino)-3-hydroxy-2-methyl-5-(methylamino)-5-oxopentyl]-N,N-dimethyl-4,5-dihydro-1,3-thiazole-4-carboxamide |
| SMILES | CNC(=O)[C@@H]([C@H](O)[C@H](C)CC1=NC(C(=O)N(C)C)CS1)N(C)C |
| InChI | InChI=1S/C15H28N4O3S/c1-9(13(20)12(18(3)4)14(21)16-2)7-11-17-10(8-23-11)15(22)19(5)6/h9-10,12-13,20H,7-8H2,1-6H3,(H,16,21)/t9-,10?,12-,13-/m1/s1 |
| InChIKey | PWYCOYHAXGMDJI-NJGBWHNRSA-N |
| XLogP | -0.35 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |