C28H34N4 — CID 118372398
6,10-ditert-butyl-1,19-dimethyl-5,7,9,15-tetrazahexacyclo[17.2.1.02,18.04,16.05,14.08,13]docosa-2,4(16),6,8(13),9,11,14,17-octaene (PubChem CID 118372398) has the molecular formula C28H34N4 and a molecular weight of 426.61 g/mol. Its IUPAC name is 6,10-ditert-butyl-1,19-dimethyl-5,7,9,15-tetrazahexacyclo[17.2.1.02,18.04,16.05,14.08,13]docosa-2,4(16),6,8(13),9,11,14,17-octaene.
| Compound Name | 6,10-ditert-butyl-1,19-dimethyl-5,7,9,15-tetrazahexacyclo[17.2.1.02,18.04,16.05,14.08,13]docosa-2,4(16),6,8(13),9,11,14,17-octaene |
|---|---|
| PubChem CID | 118372398 |
| Molecular Formula | C28H34N4 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | 6,10-ditert-butyl-1,19-dimethyl-5,7,9,15-tetrazahexacyclo[17.2.1.02,18.04,16.05,14.08,13]docosa-2,4(16),6,8(13),9,11,14,17-octaene |
| SMILES | CC(C)(C)c1ccc2c(n1)nc(C(C)(C)C)n1c3cc4c(cc3nc21)C1(C)CCC4(C)C1 |
| InChI | InChI=1S/C28H34N4/c1-25(2,3)21-10-9-16-22(30-21)31-24(26(4,5)6)32-20-14-18-17(13-19(20)29-23(16)32)27(7)11-12-28(18,8)15-27/h9-10,13-14H,11-12,15H2,1-8H3 |
| InChIKey | XWEHOTJCHUXKLJ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |