C26H46O7 — CID 118372687
2-[2-(2,7-dimethyl-8-oxononanoyl)oxyethoxy]ethyl 2,7-dimethyl-8-oxononanoate (PubChem CID 118372687) has the molecular formula C26H46O7 and a molecular weight of 470.65 g/mol. Its IUPAC name is 2-[2-(2,7-dimethyl-8-oxononanoyl)oxyethoxy]ethyl 2,7-dimethyl-8-oxononanoate.
| Compound Name | 2-[2-(2,7-dimethyl-8-oxononanoyl)oxyethoxy]ethyl 2,7-dimethyl-8-oxononanoate |
|---|---|
| PubChem CID | 118372687 |
| Molecular Formula | C26H46O7 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | 2-[2-(2,7-dimethyl-8-oxononanoyl)oxyethoxy]ethyl 2,7-dimethyl-8-oxononanoate |
| SMILES | CC(=O)C(C)CCCCC(C)C(=O)OCCOCCOC(=O)C(C)CCCCC(C)C(C)=O |
| InChI | InChI=1S/C26H46O7/c1-19(23(5)27)11-7-9-13-21(3)25(29)32-17-15-31-16-18-33-26(30)22(4)14-10-8-12-20(2)24(6)28/h19-22H,7-18H2,1-6H3 |
| InChIKey | XCFCVQZLDYDLME-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|