C21H18F2N3S+ — CID 118372798
6-fluoro-N-[2-[1-[(4-fluorophenyl)methyl]pyridin-1-ium-4-yl]ethyl]-1,3-benzothiazol-2-amine (PubChem CID 118372798) has the molecular formula C21H18F2N3S+ and a molecular weight of 382.46 g/mol. Its IUPAC name is 6-fluoro-N-[2-[1-[(4-fluorophenyl)methyl]pyridin-1-ium-4-yl]ethyl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-fluoro-N-[2-[1-[(4-fluorophenyl)methyl]pyridin-1-ium-4-yl]ethyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 118372798 |
| Molecular Formula | C21H18F2N3S+ |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 6-fluoro-N-[2-[1-[(4-fluorophenyl)methyl]pyridin-1-ium-4-yl]ethyl]-1,3-benzothiazol-2-amine |
| SMILES | Fc1ccc(C[n+]2ccc(CCNc3nc4ccc(F)cc4s3)cc2)cc1 |
| InChI | InChI=1S/C21H18F2N3S/c22-17-3-1-16(2-4-17)14-26-11-8-15(9-12-26)7-10-24-21-25-19-6-5-18(23)13-20(19)27-21/h1-6,8-9,11-13H,7,10,14H2,(H,24,25)/q+1 |
| InChIKey | DEFMHIPKLZXSIY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 28.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|