C21H38Cl2O — CID 118372871
2-[(2,4-dichlorocyclohexyl)methyl]-4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol (PubChem CID 118372871) has the molecular formula C21H38Cl2O and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-[(2,4-dichlorocyclohexyl)methyl]-4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol.
| Compound Name | 2-[(2,4-dichlorocyclohexyl)methyl]-4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 118372871 |
| Molecular Formula | C21H38Cl2O |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 2-[(2,4-dichlorocyclohexyl)methyl]-4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol |
| SMILES | CC(C)(C)CC(C)(C)C1CCC(O)C(CC2CCC(Cl)CC2Cl)C1 |
| InChI | InChI=1S/C21H38Cl2O/c1-20(2,3)13-21(4,5)16-7-9-19(24)15(11-16)10-14-6-8-17(22)12-18(14)23/h14-19,24H,6-13H2,1-5H3 |
| InChIKey | QFTRNYCGZIOWKJ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|