About 1,2,3-trimethyl-5,6-dihydro-4H-cyclopenta[b]pyrrole
1,2,3-trimethyl-5,6-dihydro-4H-cyclopenta[b]pyrrole (PubChem CID 118372975) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 1,2,3-trimethyl-5,6-dihydro-4H-cyclopenta[b]pyrrole.
Molecular Properties
| Compound Name | 1,2,3-trimethyl-5,6-dihydro-4H-cyclopenta[b]pyrrole |
| PubChem CID | 118372975 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 1,2,3-trimethyl-5,6-dihydro-4H-cyclopenta[b]pyrrole |
| SMILES | Cc1c2c(n(C)c1C)CCC2 |
| InChI | InChI=1S/C10H15N/c1-7-8(2)11(3)10-6-4-5-9(7)10/h4-6H2,1-3H3 |
| InChIKey | KBZNIGYOUUBSMO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2,3-trimethyl-5,6-dihydro-4H-cyclopenta[b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-trimethyl-5,6-dihydro-4H-cyclopenta[b]pyrrole?
The IUPAC name of 1,2,3-trimethyl-5,6-dihydro-4H-cyclopenta[b]pyrrole (CID 118372975) is 1,2,3-trimethyl-5,6-dihydro-4H-cyclopenta[b]pyrrole.
What is the SMILES notation for 1,2,3-trimethyl-5,6-dihydro-4H-cyclopenta[b]pyrrole?
The canonical SMILES for 1,2,3-trimethyl-5,6-dihydro-4H-cyclopenta[b]pyrrole is Cc1c2c(n(C)c1C)CCC2.
What is the InChIKey of 1,2,3-trimethyl-5,6-dihydro-4H-cyclopenta[b]pyrrole?
The InChIKey is KBZNIGYOUUBSMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-7-8(2)11(3)10-6-4-5-9(7)10/h4-6H2,1-3H3.
What are the key properties of 1,2,3-trimethyl-5,6-dihydro-4H-cyclopenta[b]pyrrole?
1,2,3-trimethyl-5,6-dihydro-4H-cyclopenta[b]pyrrole has a molecular weight of 149.24 g/mol, XLogP of 2.13, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-trimethyl-5,6-dihydro-4H-cyclopenta[b]pyrrole is sourced from PubChem (CID 118372975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).