C12H20O3 — CID 118373138
(2S,5R)-2,5-bis(prop-2-enoxymethyl)oxolane (PubChem CID 118373138) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (2S,5R)-2,5-bis(prop-2-enoxymethyl)oxolane.
| Compound Name | (2S,5R)-2,5-bis(prop-2-enoxymethyl)oxolane |
|---|---|
| PubChem CID | 118373138 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (2S,5R)-2,5-bis(prop-2-enoxymethyl)oxolane |
| SMILES | C=CCOC[C@H]1CC[C@@H](COCC=C)O1 |
| InChI | InChI=1S/C12H20O3/c1-3-7-13-9-11-5-6-12(15-11)10-14-8-4-2/h3-4,11-12H,1-2,5-10H2/t11-,12+ |
| InChIKey | SEJCUEXQSKJRPA-TXEJJXNPSA-N |
| XLogP | 1.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|