About 2-nitro-12-prop-2-enylquinoxalino[2,3-b][1,4]benzoxazine
2-nitro-12-prop-2-enylquinoxalino[2,3-b][1,4]benzoxazine (PubChem CID 11837326) has the molecular formula C17H12N4O3
and a molecular weight of 320.31 g/mol. Its IUPAC name is 2-nitro-12-prop-2-enylquinoxalino[2,3-b][1,4]benzoxazine.
Molecular Properties
| Compound Name | 2-nitro-12-prop-2-enylquinoxalino[2,3-b][1,4]benzoxazine |
| PubChem CID | 11837326 |
| Molecular Formula | C17H12N4O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-nitro-12-prop-2-enylquinoxalino[2,3-b][1,4]benzoxazine |
| SMILES | C=CCN1c2cc([N+](=O)[O-])ccc2Oc2nc3ccccc3nc21 |
| InChI | InChI=1S/C17H12N4O3/c1-2-9-20-14-10-11(21(22)23)7-8-15(14)24-17-16(20)18-12-5-3-4-6-13(12)19-17/h2-8,10H,1,9H2 |
| InChIKey | WEUBZXDMNRUQRW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 81.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-12-prop-2-enylquinoxalino[2,3-b][1,4]benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-12-prop-2-enylquinoxalino[2,3-b][1,4]benzoxazine?
The IUPAC name of 2-nitro-12-prop-2-enylquinoxalino[2,3-b][1,4]benzoxazine (CID 11837326) is 2-nitro-12-prop-2-enylquinoxalino[2,3-b][1,4]benzoxazine.
What is the SMILES notation for 2-nitro-12-prop-2-enylquinoxalino[2,3-b][1,4]benzoxazine?
The canonical SMILES for 2-nitro-12-prop-2-enylquinoxalino[2,3-b][1,4]benzoxazine is C=CCN1c2cc([N+](=O)[O-])ccc2Oc2nc3ccccc3nc21.
What is the InChIKey of 2-nitro-12-prop-2-enylquinoxalino[2,3-b][1,4]benzoxazine?
The InChIKey is WEUBZXDMNRUQRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N4O3/c1-2-9-20-14-10-11(21(22)23)7-8-15(14)24-17-16(20)18-12-5-3-4-6-13(12)19-17/h2-8,10H,1,9H2.
What are the key properties of 2-nitro-12-prop-2-enylquinoxalino[2,3-b][1,4]benzoxazine?
2-nitro-12-prop-2-enylquinoxalino[2,3-b][1,4]benzoxazine has a molecular weight of 320.31 g/mol, XLogP of 3.97, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-12-prop-2-enylquinoxalino[2,3-b][1,4]benzoxazine is sourced from PubChem (CID 11837326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).