About 3-(3,4-dimethyl-1,2-oxazol-5-yl)-1,3-oxazolidin-2-one
3-(3,4-dimethyl-1,2-oxazol-5-yl)-1,3-oxazolidin-2-one (PubChem CID 11837340) has the molecular formula C8H10N2O3
and a molecular weight of 182.18 g/mol. Its IUPAC name is 3-(3,4-dimethyl-1,2-oxazol-5-yl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-(3,4-dimethyl-1,2-oxazol-5-yl)-1,3-oxazolidin-2-one |
| PubChem CID | 11837340 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 3-(3,4-dimethyl-1,2-oxazol-5-yl)-1,3-oxazolidin-2-one |
| SMILES | Cc1noc(N2CCOC2=O)c1C |
| InChI | InChI=1S/C8H10N2O3/c1-5-6(2)9-13-7(5)10-3-4-12-8(10)11/h3-4H2,1-2H3 |
| InChIKey | GECRYLWSFUCROZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3,4-dimethyl-1,2-oxazol-5-yl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethyl-1,2-oxazol-5-yl)-1,3-oxazolidin-2-one?
The IUPAC name of 3-(3,4-dimethyl-1,2-oxazol-5-yl)-1,3-oxazolidin-2-one (CID 11837340) is 3-(3,4-dimethyl-1,2-oxazol-5-yl)-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-(3,4-dimethyl-1,2-oxazol-5-yl)-1,3-oxazolidin-2-one?
The canonical SMILES for 3-(3,4-dimethyl-1,2-oxazol-5-yl)-1,3-oxazolidin-2-one is Cc1noc(N2CCOC2=O)c1C.
What is the InChIKey of 3-(3,4-dimethyl-1,2-oxazol-5-yl)-1,3-oxazolidin-2-one?
The InChIKey is GECRYLWSFUCROZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3/c1-5-6(2)9-13-7(5)10-3-4-12-8(10)11/h3-4H2,1-2H3.
What are the key properties of 3-(3,4-dimethyl-1,2-oxazol-5-yl)-1,3-oxazolidin-2-one?
3-(3,4-dimethyl-1,2-oxazol-5-yl)-1,3-oxazolidin-2-one has a molecular weight of 182.18 g/mol, XLogP of 1.25, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethyl-1,2-oxazol-5-yl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 11837340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).