C14H17FN4O2S — CID 118373462
4-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethynyl]-5-fluoropyridin-3-amine (PubChem CID 118373462) has the molecular formula C14H17FN4O2S and a molecular weight of 324.38 g/mol. Its IUPAC name is 4-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethynyl]-5-fluoropyridin-3-amine.
| Compound Name | 4-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethynyl]-5-fluoropyridin-3-amine |
|---|---|
| PubChem CID | 118373462 |
| Molecular Formula | C14H17FN4O2S |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 4-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethynyl]-5-fluoropyridin-3-amine |
| SMILES | Nc1cncc(F)c1C#C[C@H]1CN[C@@H]2CCCS(=O)(=O)N1C2 |
| InChI | InChI=1S/C14H17FN4O2S/c15-13-7-17-8-14(16)12(13)4-3-11-6-18-10-2-1-5-22(20,21)19(11)9-10/h7-8,10-11,18H,1-2,5-6,9,16H2/t10-,11+/m1/s1 |
| InChIKey | CQXWOZGNBOQFDV-MNOVXSKESA-N |
| XLogP | -0.08 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|