C30H40F2N4O4S — CID 118373504
(2S)-2-amino-3-[(2R,6S)-2,6-dimethyloxan-4-yl]-N-[2-[[(6R)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]methyl]-3-fluorophenyl]-3-(4-fluorophenyl)propanamide (PubChem CID 118373504) has the molecular formula C30H40F2N4O4S and a molecular weight of 590.74 g/mol. Its IUPAC name is (2S)-2-amino-3-[(2R,6S)-2,6-dimethyloxan-4-yl]-N-[2-[[(6R)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]methyl]-3-fluorophenyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | (2S)-2-amino-3-[(2R,6S)-2,6-dimethyloxan-4-yl]-N-[2-[[(6R)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]methyl]-3-fluorophenyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 118373504 |
| Molecular Formula | C30H40F2N4O4S |
| Molecular Weight | 590.74 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | (2S)-2-amino-3-[(2R,6S)-2,6-dimethyloxan-4-yl]-N-[2-[[(6R)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]methyl]-3-fluorophenyl]-3-(4-fluorophenyl)propanamide |
| SMILES | C[C@@H]1CC(C(c2ccc(F)cc2)[C@H](N)C(=O)Nc2cccc(F)c2CC2CN[C@@H]3CCCS(=O)(=O)N2C3)C[C@H](C)O1 |
| InChI | InChI=1S/C30H40F2N4O4S/c1-18-13-21(14-19(2)40-18)28(20-8-10-22(31)11-9-20)29(33)30(37)35-27-7-3-6-26(32)25(27)15-24-16-34-23-5-4-12-41(38,39)36(24)17-23/h3,6-11,18-19,21,23-24,28-29,34H,4-5,12-17,33H2,1-2H3,(H,35,37)/t18-,19+,21?,23-,24?,28?,29+/m1/s1 |
| InChIKey | ZNBIUCDHEOJNGH-BYMZQZKFSA-N |
| XLogP | 3.53 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.74 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |