C13H9ClN4O — CID 11837351
N-(5-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)benzamide (PubChem CID 11837351) has the molecular formula C13H9ClN4O and a molecular weight of 272.70 g/mol. Its IUPAC name is N-(5-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)benzamide.
| Compound Name | N-(5-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)benzamide |
|---|---|
| PubChem CID | 11837351 |
| Molecular Formula | C13H9ClN4O |
| Molecular Weight | 272.70 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | N-(5-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)benzamide |
| SMILES | O=C(Nc1nnc2cccc(Cl)n12)c1ccccc1 |
| InChI | InChI=1S/C13H9ClN4O/c14-10-7-4-8-11-16-17-13(18(10)11)15-12(19)9-5-2-1-3-6-9/h1-8H,(H,15,17,19) |
| InChIKey | BRIGGXHVFKQCID-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.70 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|