C16H16F4N4O3S — CID 118373657
N-[4-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethynyl]-5-fluoro-3-pyridinyl]-2,2,2-trifluoroacetamide (PubChem CID 118373657) has the molecular formula C16H16F4N4O3S and a molecular weight of 420.39 g/mol. Its IUPAC name is N-[4-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethynyl]-5-fluoro-3-pyridinyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethynyl]-5-fluoro-3-pyridinyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 118373657 |
| Molecular Formula | C16H16F4N4O3S |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | N-[4-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethynyl]-5-fluoro-3-pyridinyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1cncc(F)c1C#C[C@H]1CN[C@@H]2CCCS(=O)(=O)N1C2)C(F)(F)F |
| InChI | InChI=1S/C16H16F4N4O3S/c17-13-7-21-8-14(23-15(25)16(18,19)20)12(13)4-3-11-6-22-10-2-1-5-28(26,27)24(11)9-10/h7-8,10-11,22H,1-2,5-6,9H2,(H,23,25)/t10-,11+/m1/s1 |
| InChIKey | GHEMAUJUUJSTPX-MNOVXSKESA-N |
| XLogP | 0.84 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|