About N-[2-[[(2Z,4Z)-hexa-2,4-dienylidene]amino]ethyl]prop-2-enamide
N-[2-[[(2Z,4Z)-hexa-2,4-dienylidene]amino]ethyl]prop-2-enamide (PubChem CID 118373885) has the molecular formula C11H16N2O
and a molecular weight of 192.26 g/mol. Its IUPAC name is N-[2-[[(2Z,4Z)-hexa-2,4-dienylidene]amino]ethyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-[2-[[(2Z,4Z)-hexa-2,4-dienylidene]amino]ethyl]prop-2-enamide |
| PubChem CID | 118373885 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | N-[2-[[(2Z,4Z)-hexa-2,4-dienylidene]amino]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC/N=C/C=C\C=C/C |
| InChI | InChI=1S/C11H16N2O/c1-3-5-6-7-8-12-9-10-13-11(14)4-2/h3-8H,2,9-10H2,1H3,(H,13,14)/b5-3-,7-6-,12-8+ |
| InChIKey | UCPHOOUVLDROTE-SEMBMOQSSA-N |
| XLogP | 1.49 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[[(2Z,4Z)-hexa-2,4-dienylidene]amino]ethyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[[(2Z,4Z)-hexa-2,4-dienylidene]amino]ethyl]prop-2-enamide?
The IUPAC name of N-[2-[[(2Z,4Z)-hexa-2,4-dienylidene]amino]ethyl]prop-2-enamide (CID 118373885) is N-[2-[[(2Z,4Z)-hexa-2,4-dienylidene]amino]ethyl]prop-2-enamide.
What is the SMILES notation for N-[2-[[(2Z,4Z)-hexa-2,4-dienylidene]amino]ethyl]prop-2-enamide?
The canonical SMILES for N-[2-[[(2Z,4Z)-hexa-2,4-dienylidene]amino]ethyl]prop-2-enamide is C=CC(=O)NCC/N=C/C=C\C=C/C.
What is the InChIKey of N-[2-[[(2Z,4Z)-hexa-2,4-dienylidene]amino]ethyl]prop-2-enamide?
The InChIKey is UCPHOOUVLDROTE-SEMBMOQSSA-N. The full InChI is InChI=1S/C11H16N2O/c1-3-5-6-7-8-12-9-10-13-11(14)4-2/h3-8H,2,9-10H2,1H3,(H,13,14)/b5-3-,7-6-,12-8+.
What are the key properties of N-[2-[[(2Z,4Z)-hexa-2,4-dienylidene]amino]ethyl]prop-2-enamide?
N-[2-[[(2Z,4Z)-hexa-2,4-dienylidene]amino]ethyl]prop-2-enamide has a molecular weight of 192.26 g/mol, XLogP of 1.49, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[[(2Z,4Z)-hexa-2,4-dienylidene]amino]ethyl]prop-2-enamide is sourced from PubChem (CID 118373885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).