C21H19F6NO — CID 118374117
(NE)-N-[1-[9,9-bis(3,3,3-trifluoropropyl)fluoren-2-yl]ethylidene]hydroxylamine (PubChem CID 118374117) has the molecular formula C21H19F6NO and a molecular weight of 415.38 g/mol. Its IUPAC name is (NE)-N-[1-[9,9-bis(3,3,3-trifluoropropyl)fluoren-2-yl]ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[9,9-bis(3,3,3-trifluoropropyl)fluoren-2-yl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 118374117 |
| Molecular Formula | C21H19F6NO |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | (NE)-N-[1-[9,9-bis(3,3,3-trifluoropropyl)fluoren-2-yl]ethylidene]hydroxylamine |
| SMILES | C/C(=N\O)c1ccc2c(c1)C(CCC(F)(F)F)(CCC(F)(F)F)c1ccccc1-2 |
| InChI | InChI=1S/C21H19F6NO/c1-13(28-29)14-6-7-16-15-4-2-3-5-17(15)19(18(16)12-14,8-10-20(22,23)24)9-11-21(25,26)27/h2-7,12,29H,8-11H2,1H3/b28-13+ |
| InChIKey | FLGQONYILBUOBF-XODNFHPESA-N |
| XLogP | 6.84 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|