C18H17FN4O — CID 118374154
(1S,2S,6R)-2-azido-6-(3-fluorocarbazol-9-yl)cyclohexan-1-ol (PubChem CID 118374154) has the molecular formula C18H17FN4O and a molecular weight of 324.36 g/mol. Its IUPAC name is (1S,2S,6R)-2-azido-6-(3-fluorocarbazol-9-yl)cyclohexan-1-ol.
| Compound Name | (1S,2S,6R)-2-azido-6-(3-fluorocarbazol-9-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 118374154 |
| Molecular Formula | C18H17FN4O |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (1S,2S,6R)-2-azido-6-(3-fluorocarbazol-9-yl)cyclohexan-1-ol |
| SMILES | [N-]=[N+]=N[C@H]1CCC[C@@H](n2c3ccccc3c3cc(F)ccc32)[C@@H]1O |
| InChI | InChI=1S/C18H17FN4O/c19-11-8-9-16-13(10-11)12-4-1-2-6-15(12)23(16)17-7-3-5-14(18(17)24)21-22-20/h1-2,4,6,8-10,14,17-18,24H,3,5,7H2/t14-,17+,18+/m0/s1 |
| InChIKey | LRHRTUSZKGZNRU-BMGDILEWSA-N |
| XLogP | 4.70 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|