C18H18FNO2 — CID 118374177
(1R,2S,3R)-3-(3-fluorocarbazol-9-yl)cyclohexane-1,2-diol (PubChem CID 118374177) has the molecular formula C18H18FNO2 and a molecular weight of 299.34 g/mol. Its IUPAC name is (1R,2S,3R)-3-(3-fluorocarbazol-9-yl)cyclohexane-1,2-diol.
| Compound Name | (1R,2S,3R)-3-(3-fluorocarbazol-9-yl)cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 118374177 |
| Molecular Formula | C18H18FNO2 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (1R,2S,3R)-3-(3-fluorocarbazol-9-yl)cyclohexane-1,2-diol |
| SMILES | O[C@@H]1[C@H](O)CCC[C@H]1n1c2ccccc2c2cc(F)ccc21 |
| InChI | InChI=1S/C18H18FNO2/c19-11-8-9-15-13(10-11)12-4-1-2-5-14(12)20(15)16-6-3-7-17(21)18(16)22/h1-2,4-5,8-10,16-18,21-22H,3,6-7H2/t16-,17-,18+/m1/s1 |
| InChIKey | ZORQZCVSISZJNQ-KURKYZTESA-N |
| XLogP | 3.38 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |