C18H17F2NO2 — CID 118374192
(1R,2S,3R)-3-(3,6-difluorocarbazol-9-yl)cyclohexane-1,2-diol (PubChem CID 118374192) has the molecular formula C18H17F2NO2 and a molecular weight of 317.34 g/mol. Its IUPAC name is (1R,2S,3R)-3-(3,6-difluorocarbazol-9-yl)cyclohexane-1,2-diol.
| Compound Name | (1R,2S,3R)-3-(3,6-difluorocarbazol-9-yl)cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 118374192 |
| Molecular Formula | C18H17F2NO2 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (1R,2S,3R)-3-(3,6-difluorocarbazol-9-yl)cyclohexane-1,2-diol |
| SMILES | O[C@@H]1[C@H](O)CCC[C@H]1n1c2ccc(F)cc2c2cc(F)ccc21 |
| InChI | InChI=1S/C18H17F2NO2/c19-10-4-6-14-12(8-10)13-9-11(20)5-7-15(13)21(14)16-2-1-3-17(22)18(16)23/h4-9,16-18,22-23H,1-3H2/t16-,17-,18+/m1/s1 |
| InChIKey | ZCHYARDUGHQWFS-KURKYZTESA-N |
| XLogP | 3.52 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |