About 9-bromo-3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-ol
9-bromo-3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-ol (PubChem CID 118374570) has the molecular formula C14H11BrClNO3S
and a molecular weight of 388.67 g/mol. Its IUPAC name is 9-bromo-3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-ol.
Molecular Properties
| Compound Name | 9-bromo-3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-ol |
| PubChem CID | 118374570 |
| Molecular Formula | C14H11BrClNO3S |
| Molecular Weight | 388.67 g/mol |
| Exact Mass | 386.93 |
| IUPAC Name | 9-bromo-3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-ol |
| SMILES | CN1c2ccc(Br)cc2C(O)c2ccc(Cl)cc2S1(=O)=O |
| InChI | InChI=1S/C14H11BrClNO3S/c1-17-12-5-2-8(15)6-11(12)14(18)10-4-3-9(16)7-13(10)21(17,19)20/h2-7,14,18H,1H3 |
| InChIKey | WFNUKMBRMURTOQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.67 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-bromo-3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromo-3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-ol?
The IUPAC name of 9-bromo-3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-ol (CID 118374570) is 9-bromo-3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-ol.
What is the SMILES notation for 9-bromo-3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-ol?
The canonical SMILES for 9-bromo-3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-ol is CN1c2ccc(Br)cc2C(O)c2ccc(Cl)cc2S1(=O)=O.
What is the InChIKey of 9-bromo-3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-ol?
The InChIKey is WFNUKMBRMURTOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrClNO3S/c1-17-12-5-2-8(15)6-11(12)14(18)10-4-3-9(16)7-13(10)21(17,19)20/h2-7,14,18H,1H3.
What are the key properties of 9-bromo-3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-ol?
9-bromo-3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-ol has a molecular weight of 388.67 g/mol, XLogP of 3.32, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromo-3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-ol is sourced from PubChem (CID 118374570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).