C21H31NO13S — CID 11837462
methyl (2R)-3-(hydroxymethyl)-2-(1,2,3,4,5-pentaacetyloxypentyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 11837462) has the molecular formula C21H31NO13S and a molecular weight of 537.54 g/mol. Its IUPAC name is methyl (2R)-3-(hydroxymethyl)-2-(1,2,3,4,5-pentaacetyloxypentyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl (2R)-3-(hydroxymethyl)-2-(1,2,3,4,5-pentaacetyloxypentyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 11837462 |
| Molecular Formula | C21H31NO13S |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | methyl (2R)-3-(hydroxymethyl)-2-(1,2,3,4,5-pentaacetyloxypentyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | COC(=O)C1CS[C@H](C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(COC(C)=O)OC(C)=O)N1CO |
| InChI | InChI=1S/C21H31NO13S/c1-10(24)31-7-16(32-11(2)25)17(33-12(3)26)18(34-13(4)27)19(35-14(5)28)20-22(9-23)15(8-36-20)21(29)30-6/h15-20,23H,7-9H2,1-6H3/t15?,16?,17?,18?,19?,20-/m1/s1 |
| InChIKey | OPEDNMHDBFWXJL-NSDIEPNESA-N |
| XLogP | -0.86 |
| TPSA | 181.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|