C16H19ClFN3O3 — CID 118374651
(2S,3R)-2-azido-3-(4-chloro-3-fluorophenyl)-3-[(2S,6R)-2,6-dimethyloxan-4-yl]propanoic acid (PubChem CID 118374651) has the molecular formula C16H19ClFN3O3 and a molecular weight of 355.80 g/mol. Its IUPAC name is (2S,3R)-2-azido-3-(4-chloro-3-fluorophenyl)-3-[(2S,6R)-2,6-dimethyloxan-4-yl]propanoic acid.
| Compound Name | (2S,3R)-2-azido-3-(4-chloro-3-fluorophenyl)-3-[(2S,6R)-2,6-dimethyloxan-4-yl]propanoic acid |
|---|---|
| PubChem CID | 118374651 |
| Molecular Formula | C16H19ClFN3O3 |
| Molecular Weight | 355.80 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (2S,3R)-2-azido-3-(4-chloro-3-fluorophenyl)-3-[(2S,6R)-2,6-dimethyloxan-4-yl]propanoic acid |
| SMILES | C[C@@H]1CC([C@H](c2ccc(Cl)c(F)c2)[C@H](N=[N+]=[N-])C(=O)O)C[C@H](C)O1 |
| InChI | InChI=1S/C16H19ClFN3O3/c1-8-5-11(6-9(2)24-8)14(15(16(22)23)20-21-19)10-3-4-12(17)13(18)7-10/h3-4,7-9,11,14-15H,5-6H2,1-2H3,(H,22,23)/t8-,9+,11?,14-,15-/m0/s1 |
| InChIKey | ZXCBAVWTUZGEEY-DCMVCLDMSA-N |
| XLogP | 4.53 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.80 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|