C14H16IN3O4S — CID 118374656
(2S,3R)-2-azido-3-(1,1-dioxothian-4-yl)-3-(4-iodophenyl)propanoic acid (PubChem CID 118374656) has the molecular formula C14H16IN3O4S and a molecular weight of 449.27 g/mol. Its IUPAC name is (2S,3R)-2-azido-3-(1,1-dioxothian-4-yl)-3-(4-iodophenyl)propanoic acid.
| Compound Name | (2S,3R)-2-azido-3-(1,1-dioxothian-4-yl)-3-(4-iodophenyl)propanoic acid |
|---|---|
| PubChem CID | 118374656 |
| Molecular Formula | C14H16IN3O4S |
| Molecular Weight | 449.27 g/mol |
| Exact Mass | 448.99 |
| IUPAC Name | (2S,3R)-2-azido-3-(1,1-dioxothian-4-yl)-3-(4-iodophenyl)propanoic acid |
| SMILES | [N-]=[N+]=N[C@H](C(=O)O)[C@@H](c1ccc(I)cc1)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H16IN3O4S/c15-11-3-1-9(2-4-11)12(13(14(19)20)17-18-16)10-5-7-23(21,22)8-6-10/h1-4,10,12-13H,5-8H2,(H,19,20)/t12-,13-/m0/s1 |
| InChIKey | ZSERTYQLIDZKEF-STQMWFEESA-N |
| XLogP | 2.96 |
| TPSA | 120.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|