C12H22F2N2O2 — CID 118374752
(3S,4R)-6-(4,4-difluoropiperidin-1-yl)-3-hydroxy-4-methylhexanamide (PubChem CID 118374752) has the molecular formula C12H22F2N2O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is (3S,4R)-6-(4,4-difluoropiperidin-1-yl)-3-hydroxy-4-methylhexanamide.
| Compound Name | (3S,4R)-6-(4,4-difluoropiperidin-1-yl)-3-hydroxy-4-methylhexanamide |
|---|---|
| PubChem CID | 118374752 |
| Molecular Formula | C12H22F2N2O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | (3S,4R)-6-(4,4-difluoropiperidin-1-yl)-3-hydroxy-4-methylhexanamide |
| SMILES | C[C@H](CCN1CCC(F)(F)CC1)[C@@H](O)CC(N)=O |
| InChI | InChI=1S/C12H22F2N2O2/c1-9(10(17)8-11(15)18)2-5-16-6-3-12(13,14)4-7-16/h9-10,17H,2-8H2,1H3,(H2,15,18)/t9-,10+/m1/s1 |
| InChIKey | DTAIKBYOXMGZHK-ZJUUUORDSA-N |
| XLogP | 0.98 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |