C14H20N4O4S — CID 118374764
(3S,4R)-3-hydroxy-N,4-dimethyl-5-(6-sulfamoyl-1H-benzimidazol-2-yl)pentanamide (PubChem CID 118374764) has the molecular formula C14H20N4O4S and a molecular weight of 340.41 g/mol. Its IUPAC name is (3S,4R)-3-hydroxy-N,4-dimethyl-5-(6-sulfamoyl-1H-benzimidazol-2-yl)pentanamide.
| Compound Name | (3S,4R)-3-hydroxy-N,4-dimethyl-5-(6-sulfamoyl-1H-benzimidazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 118374764 |
| Molecular Formula | C14H20N4O4S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (3S,4R)-3-hydroxy-N,4-dimethyl-5-(6-sulfamoyl-1H-benzimidazol-2-yl)pentanamide |
| SMILES | CNC(=O)C[C@H](O)[C@H](C)Cc1nc2ccc(S(N)(=O)=O)cc2[nH]1 |
| InChI | InChI=1S/C14H20N4O4S/c1-8(12(19)7-14(20)16-2)5-13-17-10-4-3-9(23(15,21)22)6-11(10)18-13/h3-4,6,8,12,19H,5,7H2,1-2H3,(H,16,20)(H,17,18)(H2,15,21,22)/t8-,12+/m1/s1 |
| InChIKey | VQVKMHJJYHMDHO-PELKAZGASA-N |
| XLogP | -0.11 |
| TPSA | 138.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |