C19H35NO4 — CID 118374863
1-[(2-methylpropan-2-yl)oxycarbonyl]-4-octylpiperidine-3-carboxylic acid (PubChem CID 118374863) has the molecular formula C19H35NO4 and a molecular weight of 341.49 g/mol. Its IUPAC name is 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-octylpiperidine-3-carboxylic acid.
| Compound Name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-octylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 118374863 |
| Molecular Formula | C19H35NO4 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-octylpiperidine-3-carboxylic acid |
| SMILES | CCCCCCCCC1CCN(C(=O)OC(C)(C)C)CC1C(=O)O |
| InChI | InChI=1S/C19H35NO4/c1-5-6-7-8-9-10-11-15-12-13-20(14-16(15)17(21)22)18(23)24-19(2,3)4/h15-16H,5-14H2,1-4H3,(H,21,22) |
| InChIKey | HCPWTXIBJDDYHA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|