C20H36O5 — CID 118375058
(1R)-1-(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)dodec-11-en-1-ol (PubChem CID 118375058) has the molecular formula C20H36O5 and a molecular weight of 356.50 g/mol. Its IUPAC name is (1R)-1-(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)dodec-11-en-1-ol.
| Compound Name | (1R)-1-(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)dodec-11-en-1-ol |
|---|---|
| PubChem CID | 118375058 |
| Molecular Formula | C20H36O5 |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | (1R)-1-(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)dodec-11-en-1-ol |
| SMILES | C=CCCCCCCCCC[C@@H](O)C1OC(OC)C2OC(C)(C)OC21 |
| InChI | InChI=1S/C20H36O5/c1-5-6-7-8-9-10-11-12-13-14-15(21)16-17-18(19(22-4)23-16)25-20(2,3)24-17/h5,15-19,21H,1,6-14H2,2-4H3/t15-,16?,17?,18?,19?/m1/s1 |
| InChIKey | BQKJHQCRGXDLTK-CPZBXZKTSA-N |
| XLogP | 3.94 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|