C22H29N5O — CID 118375392
4-[[(1R,3S)-3-methylcyclohexyl]amino]-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]pyrimidine-5-carboxamide (PubChem CID 118375392) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is 4-[[(1R,3S)-3-methylcyclohexyl]amino]-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]pyrimidine-5-carboxamide.
| Compound Name | 4-[[(1R,3S)-3-methylcyclohexyl]amino]-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 118375392 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 4-[[(1R,3S)-3-methylcyclohexyl]amino]-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]pyrimidine-5-carboxamide |
| SMILES | C[C@H]1CCC[C@@H](Nc2nc(N[C@@H]3CCCc4ccccc43)ncc2C(N)=O)C1 |
| InChI | InChI=1S/C22H29N5O/c1-14-6-4-9-16(12-14)25-21-18(20(23)28)13-24-22(27-21)26-19-11-5-8-15-7-2-3-10-17(15)19/h2-3,7,10,13-14,16,19H,4-6,8-9,11-12H2,1H3,(H2,23,28)(H2,24,25,26,27)/t14-,16+,19+/m0/s1 |
| InChIKey | SUNIGGHRXRPDPJ-ZSZQSSIHSA-N |
| XLogP | 4.06 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |