C17H20N2 — CID 11837592
15,16-diazahexacyclo[6.6.2.23,6.110,13.02,7.09,14]nonadeca-4,11,15-triene (PubChem CID 11837592) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 15,16-diazahexacyclo[6.6.2.23,6.110,13.02,7.09,14]nonadeca-4,11,15-triene.
| Compound Name | 15,16-diazahexacyclo[6.6.2.23,6.110,13.02,7.09,14]nonadeca-4,11,15-triene |
|---|---|
| PubChem CID | 11837592 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 15,16-diazahexacyclo[6.6.2.23,6.110,13.02,7.09,14]nonadeca-4,11,15-triene |
| SMILES | C1=CC2CCC1C1C3N=NC(C21)C1C2C=CC(C2)C31 |
| InChI | InChI=1S/C17H20N2/c1-2-9-4-3-8(1)12-13(9)17-15-11-6-5-10(7-11)14(15)16(12)18-19-17/h1-2,5-6,8-17H,3-4,7H2 |
| InChIKey | JYYHXKDYHIIMMO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|