C28H26N5P — CID 118376488
4-N,6-N-dimethyl-4-N,6-N,2,2-tetraphenyl-1,3,5-triaza-2λ5-phosphacyclohexa-1,3,5-triene-4,6-diamine (PubChem CID 118376488) has the molecular formula C28H26N5P and a molecular weight of 463.53 g/mol. Its IUPAC name is 4-N,6-N-dimethyl-4-N,6-N,2,2-tetraphenyl-1,3,5-triaza-2λ5-phosphacyclohexa-1,3,5-triene-4,6-diamine.
| Compound Name | 4-N,6-N-dimethyl-4-N,6-N,2,2-tetraphenyl-1,3,5-triaza-2λ5-phosphacyclohexa-1,3,5-triene-4,6-diamine |
|---|---|
| PubChem CID | 118376488 |
| Molecular Formula | C28H26N5P |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 4-N,6-N-dimethyl-4-N,6-N,2,2-tetraphenyl-1,3,5-triaza-2λ5-phosphacyclohexa-1,3,5-triene-4,6-diamine |
| SMILES | CN(C1=NC(N(C)c2ccccc2)=NP(c2ccccc2)(c2ccccc2)=N1)c1ccccc1 |
| InChI | InChI=1S/C28H26N5P/c1-32(23-15-7-3-8-16-23)27-29-28(33(2)24-17-9-4-10-18-24)31-34(30-27,25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22H,1-2H3 |
| InChIKey | KXVASDAZAUMBJO-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 43.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|