C22H10Cl8N2O6 — CID 11837719
2,6-bis(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)hexanoic acid (PubChem CID 11837719) has the molecular formula C22H10Cl8N2O6 and a molecular weight of 681.95 g/mol. Its IUPAC name is 2,6-bis(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)hexanoic acid.
| Compound Name | 2,6-bis(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)hexanoic acid |
|---|---|
| PubChem CID | 11837719 |
| Molecular Formula | C22H10Cl8N2O6 |
| Molecular Weight | 681.95 g/mol |
| Exact Mass | 677.80 |
| IUPAC Name | 2,6-bis(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)hexanoic acid |
| SMILES | O=C(O)C(CCCCN1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O)N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C22H10Cl8N2O6/c23-10-6-7(11(24)15(28)14(10)27)19(34)31(18(6)33)4-2-1-3-5(22(37)38)32-20(35)8-9(21(32)36)13(26)17(30)16(29)12(8)25/h5H,1-4H2,(H,37,38) |
| InChIKey | FQBXAVGTWOQVDA-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.95 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|