C43H41ClF2O8 — CID 118377880
(2R,3S,4S,5R,6S)-6-[4-chloro-3-[(2,3-difluoro-4-methoxyphenyl)methyl]phenyl]-2-(hydroxymethyl)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane-2-carbaldehyde (PubChem CID 118377880) has the molecular formula C43H41ClF2O8 and a molecular weight of 759.24 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-6-[4-chloro-3-[(2,3-difluoro-4-methoxyphenyl)methyl]phenyl]-2-(hydroxymethyl)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane-2-carbaldehyde.
| Compound Name | (2R,3S,4S,5R,6S)-6-[4-chloro-3-[(2,3-difluoro-4-methoxyphenyl)methyl]phenyl]-2-(hydroxymethyl)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane-2-carbaldehyde |
|---|---|
| PubChem CID | 118377880 |
| Molecular Formula | C43H41ClF2O8 |
| Molecular Weight | 759.24 g/mol |
| Exact Mass | 758.25 |
| IUPAC Name | (2R,3S,4S,5R,6S)-6-[4-chloro-3-[(2,3-difluoro-4-methoxyphenyl)methyl]phenyl]-2-(hydroxymethyl)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane-2-carbaldehyde |
| SMILES | COc1ccc(Cc2cc([C@]3(OC)O[C@](C=O)(CO)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)ccc2Cl)c(F)c1F |
| InChI | InChI=1S/C43H41ClF2O8/c1-49-36-21-18-32(37(45)38(36)46)22-33-23-34(19-20-35(33)44)43(50-2)41(53-26-31-16-10-5-11-17-31)39(51-24-29-12-6-3-7-13-29)40(42(27-47,28-48)54-43)52-25-30-14-8-4-9-15-30/h3-21,23,27,39-41,48H,22,24-26,28H2,1-2H3/t39-,40-,41+,42+,43-/m0/s1 |
| InChIKey | CAHINGDMAAPWQV-SPAQEMODSA-N |
| XLogP | 7.73 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.24 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|