C17H21Cl2N5OS — CID 118378173
N-[(2-chloro-4-pyridinyl)oxy]-1-(2-methylsulfanyl-4-piperidin-4-ylpyrimidin-5-yl)ethanimine;hydrochloride (PubChem CID 118378173) has the molecular formula C17H21Cl2N5OS and a molecular weight of 414.36 g/mol. Its IUPAC name is N-[(2-chloro-4-pyridinyl)oxy]-1-(2-methylsulfanyl-4-piperidin-4-ylpyrimidin-5-yl)ethanimine;hydrochloride.
| Compound Name | N-[(2-chloro-4-pyridinyl)oxy]-1-(2-methylsulfanyl-4-piperidin-4-ylpyrimidin-5-yl)ethanimine;hydrochloride |
|---|---|
| PubChem CID | 118378173 |
| Molecular Formula | C17H21Cl2N5OS |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | N-[(2-chloro-4-pyridinyl)oxy]-1-(2-methylsulfanyl-4-piperidin-4-ylpyrimidin-5-yl)ethanimine;hydrochloride |
| SMILES | CSc1ncc(C(C)=NOc2ccnc(Cl)c2)c(C2CCNCC2)n1.Cl |
| InChI | InChI=1S/C17H20ClN5OS.ClH/c1-11(23-24-13-5-8-20-15(18)9-13)14-10-21-17(25-2)22-16(14)12-3-6-19-7-4-12;/h5,8-10,12,19H,3-4,6-7H2,1-2H3;1H |
| InChIKey | FXUBIEGTIHINGL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|