3-oxa-6-azabicyclo[3.1.1]heptane;2,2,2-trifluoroacetic acid

C7H10F3NO3 — CID 118378892

IUPAC3-oxa-6-azabicyclo[3.1.1]heptane;2,2,2-trifluoroacetic acid
SMILESC1OCC2CC1N2.O=C(O)C(F)(F)F
InChIInChI=1S/C5H9NO.C2HF3O2/c1-4-2-7-3-5(1)6-4;3-2(4,5)1(6)7/h4-6H,1-3H2;(H,6,7)
InChIKeyZHTUKSCLFOSOMO-UHFFFAOYSA-N
MW213.15 g/mol
LogP0.38
Rot. Bonds

About 3-oxa-6-azabicyclo[3.1.1]heptane;2,2,2-trifluoroacetic acid

3-oxa-6-azabicyclo[3.1.1]heptane;2,2,2-trifluoroacetic acid (PubChem CID 118378892) has the molecular formula C7H10F3NO3 and a molecular weight of 213.15 g/mol. Its IUPAC name is 3-oxa-6-azabicyclo[3.1.1]heptane;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name3-oxa-6-azabicyclo[3.1.1]heptane;2,2,2-trifluoroacetic acid
PubChem CID118378892
Molecular FormulaC7H10F3NO3
Molecular Weight213.15 g/mol
Exact Mass213.06
IUPAC Name3-oxa-6-azabicyclo[3.1.1]heptane;2,2,2-trifluoroacetic acid
SMILESC1OCC2CC1N2.O=C(O)C(F)(F)F
InChIInChI=1S/C5H9NO.C2HF3O2/c1-4-2-7-3-5(1)6-4;3-2(4,5)1(6)7/h4-6H,1-3H2;(H,6,7)
InChIKeyZHTUKSCLFOSOMO-UHFFFAOYSA-N
XLogP0.38
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.15
LogP ≤ 50.38
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-oxa-6-azabicyclo[3.1.1]heptane;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-oxa-6-azabicyclo[3.1.1]heptane;2,2,2-trifluoroacetic acid?
The IUPAC name of 3-oxa-6-azabicyclo[3.1.1]heptane;2,2,2-trifluoroacetic acid (CID 118378892) is 3-oxa-6-azabicyclo[3.1.1]heptane;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 3-oxa-6-azabicyclo[3.1.1]heptane;2,2,2-trifluoroacetic acid?
The canonical SMILES for 3-oxa-6-azabicyclo[3.1.1]heptane;2,2,2-trifluoroacetic acid is C1OCC2CC1N2.O=C(O)C(F)(F)F.
What is the InChIKey of 3-oxa-6-azabicyclo[3.1.1]heptane;2,2,2-trifluoroacetic acid?
The InChIKey is ZHTUKSCLFOSOMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.C2HF3O2/c1-4-2-7-3-5(1)6-4;3-2(4,5)1(6)7/h4-6H,1-3H2;(H,6,7).
What are the key properties of 3-oxa-6-azabicyclo[3.1.1]heptane;2,2,2-trifluoroacetic acid?
3-oxa-6-azabicyclo[3.1.1]heptane;2,2,2-trifluoroacetic acid has a molecular weight of 213.15 g/mol, XLogP of 0.38, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxa-6-azabicyclo[3.1.1]heptane;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 118378892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).