C11H16IN3O2 — CID 11837908
(2,6-dimethylmorpholin-4-yl)-(4-iodo-1-methylpyrazol-3-yl)methanone (PubChem CID 11837908) has the molecular formula C11H16IN3O2 and a molecular weight of 349.17 g/mol. Its IUPAC name is (2,6-dimethylmorpholin-4-yl)-(4-iodo-1-methylpyrazol-3-yl)methanone.
| Compound Name | (2,6-dimethylmorpholin-4-yl)-(4-iodo-1-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 11837908 |
| Molecular Formula | C11H16IN3O2 |
| Molecular Weight | 349.17 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | (2,6-dimethylmorpholin-4-yl)-(4-iodo-1-methylpyrazol-3-yl)methanone |
| SMILES | CC1CN(C(=O)c2nn(C)cc2I)CC(C)O1 |
| InChI | InChI=1S/C11H16IN3O2/c1-7-4-15(5-8(2)17-7)11(16)10-9(12)6-14(3)13-10/h6-8H,4-5H2,1-3H3 |
| InChIKey | WGFHSNLGSKIBKK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.17 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|