About [2-[[(2R,3S)-3-amino-4-oxoazetidin-2-yl]methyl]tetrazol-5-yl]methyl-tert-butylcarbamic acid
[2-[[(2R,3S)-3-amino-4-oxoazetidin-2-yl]methyl]tetrazol-5-yl]methyl-tert-butylcarbamic acid (PubChem CID 118380241) has the molecular formula C11H19N7O3
and a molecular weight of 297.32 g/mol. Its IUPAC name is [2-[[(2R,3S)-3-amino-4-oxoazetidin-2-yl]methyl]tetrazol-5-yl]methyl-tert-butylcarbamic acid.
Molecular Properties
| Compound Name | [2-[[(2R,3S)-3-amino-4-oxoazetidin-2-yl]methyl]tetrazol-5-yl]methyl-tert-butylcarbamic acid |
| PubChem CID | 118380241 |
| Molecular Formula | C11H19N7O3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | [2-[[(2R,3S)-3-amino-4-oxoazetidin-2-yl]methyl]tetrazol-5-yl]methyl-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(Cc1nnn(C[C@H]2NC(=O)[C@H]2N)n1)C(=O)O |
| InChI | InChI=1S/C11H19N7O3/c1-11(2,3)17(10(20)21)5-7-14-16-18(15-7)4-6-8(12)9(19)13-6/h6,8H,4-5,12H2,1-3H3,(H,13,19)(H,20,21)/t6-,8+/m1/s1 |
| InChIKey | UCSSTAZBKONKRU-SVRRBLITSA-N |
| XLogP | -1.22 |
| TPSA | 139.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-[[(2R,3S)-3-amino-4-oxoazetidin-2-yl]methyl]tetrazol-5-yl]methyl-tert-butylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[(2R,3S)-3-amino-4-oxoazetidin-2-yl]methyl]tetrazol-5-yl]methyl-tert-butylcarbamic acid?
The IUPAC name of [2-[[(2R,3S)-3-amino-4-oxoazetidin-2-yl]methyl]tetrazol-5-yl]methyl-tert-butylcarbamic acid (CID 118380241) is [2-[[(2R,3S)-3-amino-4-oxoazetidin-2-yl]methyl]tetrazol-5-yl]methyl-tert-butylcarbamic acid.
What is the SMILES notation for [2-[[(2R,3S)-3-amino-4-oxoazetidin-2-yl]methyl]tetrazol-5-yl]methyl-tert-butylcarbamic acid?
The canonical SMILES for [2-[[(2R,3S)-3-amino-4-oxoazetidin-2-yl]methyl]tetrazol-5-yl]methyl-tert-butylcarbamic acid is CC(C)(C)N(Cc1nnn(C[C@H]2NC(=O)[C@H]2N)n1)C(=O)O.
What is the InChIKey of [2-[[(2R,3S)-3-amino-4-oxoazetidin-2-yl]methyl]tetrazol-5-yl]methyl-tert-butylcarbamic acid?
The InChIKey is UCSSTAZBKONKRU-SVRRBLITSA-N. The full InChI is InChI=1S/C11H19N7O3/c1-11(2,3)17(10(20)21)5-7-14-16-18(15-7)4-6-8(12)9(19)13-6/h6,8H,4-5,12H2,1-3H3,(H,13,19)(H,20,21)/t6-,8+/m1/s1.
What are the key properties of [2-[[(2R,3S)-3-amino-4-oxoazetidin-2-yl]methyl]tetrazol-5-yl]methyl-tert-butylcarbamic acid?
[2-[[(2R,3S)-3-amino-4-oxoazetidin-2-yl]methyl]tetrazol-5-yl]methyl-tert-butylcarbamic acid has a molecular weight of 297.32 g/mol, XLogP of -1.22, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[(2R,3S)-3-amino-4-oxoazetidin-2-yl]methyl]tetrazol-5-yl]methyl-tert-butylcarbamic acid is sourced from PubChem (CID 118380241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).