C26H25ClF6N4O2 — CID 118380394
N-[[4-chloro-3-[4-methoxy-6-[3-propan-2-yl-4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide (PubChem CID 118380394) has the molecular formula C26H25ClF6N4O2 and a molecular weight of 574.95 g/mol. Its IUPAC name is N-[[4-chloro-3-[4-methoxy-6-[3-propan-2-yl-4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide.
| Compound Name | N-[[4-chloro-3-[4-methoxy-6-[3-propan-2-yl-4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 118380394 |
| Molecular Formula | C26H25ClF6N4O2 |
| Molecular Weight | 574.95 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | N-[[4-chloro-3-[4-methoxy-6-[3-propan-2-yl-4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide |
| SMILES | COc1nc(-c2ccc(C(F)(F)F)c(C(C)C)c2)nc(-c2cc(CNC(=O)C(C)(C)C(F)(F)F)ccc2Cl)n1 |
| InChI | InChI=1S/C26H25ClF6N4O2/c1-13(2)16-11-15(7-8-18(16)25(28,29)30)20-35-21(37-23(36-20)39-5)17-10-14(6-9-19(17)27)12-34-22(38)24(3,4)26(31,32)33/h6-11,13H,12H2,1-5H3,(H,34,38) |
| InChIKey | PGAMVDMPULVBDE-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.95 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |