About N-(3-cyclopropyl-1-methylpyrazol-5-yl)-5-(furan-3-yl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine
N-(3-cyclopropyl-1-methylpyrazol-5-yl)-5-(furan-3-yl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 118380618) has the molecular formula C16H15N7O
and a molecular weight of 321.34 g/mol. Its IUPAC name is N-(3-cyclopropyl-1-methylpyrazol-5-yl)-5-(furan-3-yl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | N-(3-cyclopropyl-1-methylpyrazol-5-yl)-5-(furan-3-yl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine |
| PubChem CID | 118380618 |
| Molecular Formula | C16H15N7O |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | N-(3-cyclopropyl-1-methylpyrazol-5-yl)-5-(furan-3-yl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | Cn1nc(C2CC2)cc1Nc1nc(-c2ccoc2)nc2cn[nH]c12 |
| InChI | InChI=1S/C16H15N7O/c1-23-13(6-11(22-23)9-2-3-9)19-16-14-12(7-17-21-14)18-15(20-16)10-4-5-24-8-10/h4-9H,2-3H2,1H3,(H,17,21)(H,18,19,20) |
| InChIKey | UHOGVCAIXMLGEO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(3-cyclopropyl-1-methylpyrazol-5-yl)-5-(furan-3-yl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-cyclopropyl-1-methylpyrazol-5-yl)-5-(furan-3-yl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine?
The IUPAC name of N-(3-cyclopropyl-1-methylpyrazol-5-yl)-5-(furan-3-yl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine (CID 118380618) is N-(3-cyclopropyl-1-methylpyrazol-5-yl)-5-(furan-3-yl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine.
What is the SMILES notation for N-(3-cyclopropyl-1-methylpyrazol-5-yl)-5-(furan-3-yl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine?
The canonical SMILES for N-(3-cyclopropyl-1-methylpyrazol-5-yl)-5-(furan-3-yl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine is Cn1nc(C2CC2)cc1Nc1nc(-c2ccoc2)nc2cn[nH]c12.
What is the InChIKey of N-(3-cyclopropyl-1-methylpyrazol-5-yl)-5-(furan-3-yl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine?
The InChIKey is UHOGVCAIXMLGEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N7O/c1-23-13(6-11(22-23)9-2-3-9)19-16-14-12(7-17-21-14)18-15(20-16)10-4-5-24-8-10/h4-9H,2-3H2,1H3,(H,17,21)(H,18,19,20).
What are the key properties of N-(3-cyclopropyl-1-methylpyrazol-5-yl)-5-(furan-3-yl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine?
N-(3-cyclopropyl-1-methylpyrazol-5-yl)-5-(furan-3-yl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine has a molecular weight of 321.34 g/mol, XLogP of 2.97, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-cyclopropyl-1-methylpyrazol-5-yl)-5-(furan-3-yl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine is sourced from PubChem (CID 118380618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).