About 1-[(2-chloro-6-fluorophenyl)methyl]-3-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]urea
1-[(2-chloro-6-fluorophenyl)methyl]-3-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]urea (PubChem CID 118380797) has the molecular formula C16H16ClFN6O
and a molecular weight of 362.80 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-3-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]urea.
Molecular Properties
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-3-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]urea |
| PubChem CID | 118380797 |
| Molecular Formula | C16H16ClFN6O |
| Molecular Weight | 362.80 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-3-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]urea |
| SMILES | CCNc1n[nH]c2cc(NC(=O)NCc3c(F)cccc3Cl)ncc12 |
| InChI | InChI=1S/C16H16ClFN6O/c1-2-19-15-10-8-20-14(6-13(10)23-24-15)22-16(25)21-7-9-11(17)4-3-5-12(9)18/h3-6,8H,2,7H2,1H3,(H2,19,23,24)(H2,20,21,22,25) |
| InChIKey | YAQBSKZGDRQGIS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.80 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(2-chloro-6-fluorophenyl)methyl]-3-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-chloro-6-fluorophenyl)methyl]-3-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]urea?
The IUPAC name of 1-[(2-chloro-6-fluorophenyl)methyl]-3-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]urea (CID 118380797) is 1-[(2-chloro-6-fluorophenyl)methyl]-3-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]urea.
What is the SMILES notation for 1-[(2-chloro-6-fluorophenyl)methyl]-3-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]urea?
The canonical SMILES for 1-[(2-chloro-6-fluorophenyl)methyl]-3-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]urea is CCNc1n[nH]c2cc(NC(=O)NCc3c(F)cccc3Cl)ncc12.
What is the InChIKey of 1-[(2-chloro-6-fluorophenyl)methyl]-3-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]urea?
The InChIKey is YAQBSKZGDRQGIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClFN6O/c1-2-19-15-10-8-20-14(6-13(10)23-24-15)22-16(25)21-7-9-11(17)4-3-5-12(9)18/h3-6,8H,2,7H2,1H3,(H2,19,23,24)(H2,20,21,22,25).
What are the key properties of 1-[(2-chloro-6-fluorophenyl)methyl]-3-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]urea?
1-[(2-chloro-6-fluorophenyl)methyl]-3-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]urea has a molecular weight of 362.80 g/mol, XLogP of 3.50, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-chloro-6-fluorophenyl)methyl]-3-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]urea is sourced from PubChem (CID 118380797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).