C27H32N6O2 — CID 118381343
N-(1-but-2-ynylpiperidin-4-yl)-5-[5-(morpholin-4-ylmethyl)-3-pyridinyl]-1H-indazole-3-carboxamide (PubChem CID 118381343) has the molecular formula C27H32N6O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is N-(1-but-2-ynylpiperidin-4-yl)-5-[5-(morpholin-4-ylmethyl)-3-pyridinyl]-1H-indazole-3-carboxamide.
| Compound Name | N-(1-but-2-ynylpiperidin-4-yl)-5-[5-(morpholin-4-ylmethyl)-3-pyridinyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 118381343 |
| Molecular Formula | C27H32N6O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | N-(1-but-2-ynylpiperidin-4-yl)-5-[5-(morpholin-4-ylmethyl)-3-pyridinyl]-1H-indazole-3-carboxamide |
| SMILES | CC#CCN1CCC(NC(=O)c2n[nH]c3ccc(-c4cncc(CN5CCOCC5)c4)cc23)CC1 |
| InChI | InChI=1S/C27H32N6O2/c1-2-3-8-32-9-6-23(7-10-32)29-27(34)26-24-16-21(4-5-25(24)30-31-26)22-15-20(17-28-18-22)19-33-11-13-35-14-12-33/h4-5,15-18,23H,6-14,19H2,1H3,(H,29,34)(H,30,31) |
| InChIKey | BETQRCGBNKLSJQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|