C20H18FN7O — CID 118381394
1-[3-[(6-fluoro-3-pyridinyl)amino]-1H-pyrazolo[4,3-c]pyridin-6-yl]-3-[(1R)-1-phenylethyl]urea (PubChem CID 118381394) has the molecular formula C20H18FN7O and a molecular weight of 391.41 g/mol. Its IUPAC name is 1-[3-[(6-fluoro-3-pyridinyl)amino]-1H-pyrazolo[4,3-c]pyridin-6-yl]-3-[(1R)-1-phenylethyl]urea.
| Compound Name | 1-[3-[(6-fluoro-3-pyridinyl)amino]-1H-pyrazolo[4,3-c]pyridin-6-yl]-3-[(1R)-1-phenylethyl]urea |
|---|---|
| PubChem CID | 118381394 |
| Molecular Formula | C20H18FN7O |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 1-[3-[(6-fluoro-3-pyridinyl)amino]-1H-pyrazolo[4,3-c]pyridin-6-yl]-3-[(1R)-1-phenylethyl]urea |
| SMILES | C[C@@H](NC(=O)Nc1cc2[nH]nc(Nc3ccc(F)nc3)c2cn1)c1ccccc1 |
| InChI | InChI=1S/C20H18FN7O/c1-12(13-5-3-2-4-6-13)24-20(29)26-18-9-16-15(11-23-18)19(28-27-16)25-14-7-8-17(21)22-10-14/h2-12H,1H3,(H2,25,27,28)(H2,23,24,26,29)/t12-/m1/s1 |
| InChIKey | ZBPFVDHGUBHKOE-GFCCVEGCSA-N |
| XLogP | 4.12 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|