C26H27N5O — CID 118382272
5-[5-[(4-methylpiperidin-1-yl)methyl]-3-pyridinyl]-N-phenyl-1H-indazole-3-carboxamide (PubChem CID 118382272) has the molecular formula C26H27N5O and a molecular weight of 425.54 g/mol. Its IUPAC name is 5-[5-[(4-methylpiperidin-1-yl)methyl]-3-pyridinyl]-N-phenyl-1H-indazole-3-carboxamide.
| Compound Name | 5-[5-[(4-methylpiperidin-1-yl)methyl]-3-pyridinyl]-N-phenyl-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 118382272 |
| Molecular Formula | C26H27N5O |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 5-[5-[(4-methylpiperidin-1-yl)methyl]-3-pyridinyl]-N-phenyl-1H-indazole-3-carboxamide |
| SMILES | CC1CCN(Cc2cncc(-c3ccc4[nH]nc(C(=O)Nc5ccccc5)c4c3)c2)CC1 |
| InChI | InChI=1S/C26H27N5O/c1-18-9-11-31(12-10-18)17-19-13-21(16-27-15-19)20-7-8-24-23(14-20)25(30-29-24)26(32)28-22-5-3-2-4-6-22/h2-8,13-16,18H,9-12,17H2,1H3,(H,28,32)(H,29,30) |
| InChIKey | BWQUOTYZWWYZRD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |