C20H13F2N3O — CID 118382349
5-(2,3-difluorophenyl)-N-phenyl-1H-indazole-3-carboxamide (PubChem CID 118382349) has the molecular formula C20H13F2N3O and a molecular weight of 349.34 g/mol. Its IUPAC name is 5-(2,3-difluorophenyl)-N-phenyl-1H-indazole-3-carboxamide.
| Compound Name | 5-(2,3-difluorophenyl)-N-phenyl-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 118382349 |
| Molecular Formula | C20H13F2N3O |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 5-(2,3-difluorophenyl)-N-phenyl-1H-indazole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1n[nH]c2ccc(-c3cccc(F)c3F)cc12 |
| InChI | InChI=1S/C20H13F2N3O/c21-16-8-4-7-14(18(16)22)12-9-10-17-15(11-12)19(25-24-17)20(26)23-13-5-2-1-3-6-13/h1-11H,(H,23,26)(H,24,25) |
| InChIKey | YIUBBXKKEADDLG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |