About 6-bromo-2-(2-chloroethyl)-1,3-benzoxazole
6-bromo-2-(2-chloroethyl)-1,3-benzoxazole (PubChem CID 118382707) has the molecular formula C9H7BrClNO
and a molecular weight of 260.52 g/mol. Its IUPAC name is 6-bromo-2-(2-chloroethyl)-1,3-benzoxazole.
Molecular Properties
| Compound Name | 6-bromo-2-(2-chloroethyl)-1,3-benzoxazole |
| PubChem CID | 118382707 |
| Molecular Formula | C9H7BrClNO |
| Molecular Weight | 260.52 g/mol |
| Exact Mass | 258.94 |
| IUPAC Name | 6-bromo-2-(2-chloroethyl)-1,3-benzoxazole |
| SMILES | ClCCc1nc2ccc(Br)cc2o1 |
| InChI | InChI=1S/C9H7BrClNO/c10-6-1-2-7-8(5-6)13-9(12-7)3-4-11/h1-2,5H,3-4H2 |
| InChIKey | HQNXKQZUAHXPAP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2-(2-chloroethyl)-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-(2-chloroethyl)-1,3-benzoxazole?
The IUPAC name of 6-bromo-2-(2-chloroethyl)-1,3-benzoxazole (CID 118382707) is 6-bromo-2-(2-chloroethyl)-1,3-benzoxazole.
What is the SMILES notation for 6-bromo-2-(2-chloroethyl)-1,3-benzoxazole?
The canonical SMILES for 6-bromo-2-(2-chloroethyl)-1,3-benzoxazole is ClCCc1nc2ccc(Br)cc2o1.
What is the InChIKey of 6-bromo-2-(2-chloroethyl)-1,3-benzoxazole?
The InChIKey is HQNXKQZUAHXPAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrClNO/c10-6-1-2-7-8(5-6)13-9(12-7)3-4-11/h1-2,5H,3-4H2.
What are the key properties of 6-bromo-2-(2-chloroethyl)-1,3-benzoxazole?
6-bromo-2-(2-chloroethyl)-1,3-benzoxazole has a molecular weight of 260.52 g/mol, XLogP of 3.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-(2-chloroethyl)-1,3-benzoxazole is sourced from PubChem (CID 118382707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).