About (Z)-1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)ethenesulfonamide
(Z)-1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)ethenesulfonamide (PubChem CID 118384206) has the molecular formula C21H25N3O4S
and a molecular weight of 415.52 g/mol. Its IUPAC name is (Z)-1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)ethenesulfonamide.
Molecular Properties
| Compound Name | (Z)-1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)ethenesulfonamide |
| PubChem CID | 118384206 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (Z)-1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)ethenesulfonamide |
| SMILES | N#C/C(=C/c1ccc2cc(N3CCCCC3)ccc2c1)S(=O)(=O)NCC(O)CO |
| InChI | InChI=1S/C21H25N3O4S/c22-13-21(29(27,28)23-14-20(26)15-25)11-16-4-5-18-12-19(7-6-17(18)10-16)24-8-2-1-3-9-24/h4-7,10-12,20,23,25-26H,1-3,8-9,14-15H2/b21-11- |
| InChIKey | AEKHKXRZUFTQSY-NHDPSOOVSA-N |
| XLogP | 1.97 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)ethenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)ethenesulfonamide?
The IUPAC name of (Z)-1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)ethenesulfonamide (CID 118384206) is (Z)-1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)ethenesulfonamide.
What is the SMILES notation for (Z)-1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)ethenesulfonamide?
The canonical SMILES for (Z)-1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)ethenesulfonamide is N#C/C(=C/c1ccc2cc(N3CCCCC3)ccc2c1)S(=O)(=O)NCC(O)CO.
What is the InChIKey of (Z)-1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)ethenesulfonamide?
The InChIKey is AEKHKXRZUFTQSY-NHDPSOOVSA-N. The full InChI is InChI=1S/C21H25N3O4S/c22-13-21(29(27,28)23-14-20(26)15-25)11-16-4-5-18-12-19(7-6-17(18)10-16)24-8-2-1-3-9-24/h4-7,10-12,20,23,25-26H,1-3,8-9,14-15H2/b21-11-.
What are the key properties of (Z)-1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)ethenesulfonamide?
(Z)-1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)ethenesulfonamide has a molecular weight of 415.52 g/mol, XLogP of 1.97, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)ethenesulfonamide is sourced from PubChem (CID 118384206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).