C31H26FN3O6 — CID 118384361
2-[5-[3-(tert-butylcarbamoyl)phenyl]-2-(4-fluorophenyl)-3-(methylcarbamoyl)-6H-furo[2,3-e]indol-8-yl]-2-oxoacetic acid (PubChem CID 118384361) has the molecular formula C31H26FN3O6 and a molecular weight of 555.56 g/mol. Its IUPAC name is 2-[5-[3-(tert-butylcarbamoyl)phenyl]-2-(4-fluorophenyl)-3-(methylcarbamoyl)-6H-furo[2,3-e]indol-8-yl]-2-oxoacetic acid.
| Compound Name | 2-[5-[3-(tert-butylcarbamoyl)phenyl]-2-(4-fluorophenyl)-3-(methylcarbamoyl)-6H-furo[2,3-e]indol-8-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 118384361 |
| Molecular Formula | C31H26FN3O6 |
| Molecular Weight | 555.56 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | 2-[5-[3-(tert-butylcarbamoyl)phenyl]-2-(4-fluorophenyl)-3-(methylcarbamoyl)-6H-furo[2,3-e]indol-8-yl]-2-oxoacetic acid |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2c1cc(-c1cccc(C(=O)NC(C)(C)C)c1)c1[nH]cc(C(=O)C(=O)O)c12 |
| InChI | InChI=1S/C31H26FN3O6/c1-31(2,3)35-28(37)17-7-5-6-16(12-17)19-13-20-23(29(38)33-4)26(15-8-10-18(32)11-9-15)41-27(20)22-21(14-34-24(19)22)25(36)30(39)40/h5-14,34H,1-4H3,(H,33,38)(H,35,37)(H,39,40) |
| InChIKey | HEAYUAMFXQAHKO-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 141.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.56 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|