C25H20N4 — CID 11838440
(4R,4aS)-2-amino-4,6-diphenyl-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile (PubChem CID 11838440) has the molecular formula C25H20N4 and a molecular weight of 376.46 g/mol. Its IUPAC name is (4R,4aS)-2-amino-4,6-diphenyl-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile.
| Compound Name | (4R,4aS)-2-amino-4,6-diphenyl-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 11838440 |
| Molecular Formula | C25H20N4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (4R,4aS)-2-amino-4,6-diphenyl-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)[C@@H](c2ccccc2)[C@@H]2CC(c3ccccc3)CC=C12 |
| InChI | InChI=1S/C25H20N4/c26-14-22-20-12-11-19(17-7-3-1-4-8-17)13-21(20)23(18-9-5-2-6-10-18)25(15-27,16-28)24(22)29/h1-10,12,19,21,23H,11,13,29H2/t19?,21-,23+/m1/s1 |
| InChIKey | SVKRRWGGOBPWRH-LVPCDLKWSA-N |
| XLogP | 4.67 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|