About 7-methoxy-9-methyl-3,4-dihydropyrido[3,4-b]indole
7-methoxy-9-methyl-3,4-dihydropyrido[3,4-b]indole (PubChem CID 118384447) has the molecular formula C13H14N2O
and a molecular weight of 214.27 g/mol. Its IUPAC name is 7-methoxy-9-methyl-3,4-dihydropyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 7-methoxy-9-methyl-3,4-dihydropyrido[3,4-b]indole |
| PubChem CID | 118384447 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 7-methoxy-9-methyl-3,4-dihydropyrido[3,4-b]indole |
| SMILES | COc1ccc2c3c(n(C)c2c1)C=NCC3 |
| InChI | InChI=1S/C13H14N2O/c1-15-12-7-9(16-2)3-4-10(12)11-5-6-14-8-13(11)15/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | UQRVIRARGUQWGY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxy-9-methyl-3,4-dihydropyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-9-methyl-3,4-dihydropyrido[3,4-b]indole?
The IUPAC name of 7-methoxy-9-methyl-3,4-dihydropyrido[3,4-b]indole (CID 118384447) is 7-methoxy-9-methyl-3,4-dihydropyrido[3,4-b]indole.
What is the SMILES notation for 7-methoxy-9-methyl-3,4-dihydropyrido[3,4-b]indole?
The canonical SMILES for 7-methoxy-9-methyl-3,4-dihydropyrido[3,4-b]indole is COc1ccc2c3c(n(C)c2c1)C=NCC3.
What is the InChIKey of 7-methoxy-9-methyl-3,4-dihydropyrido[3,4-b]indole?
The InChIKey is UQRVIRARGUQWGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O/c1-15-12-7-9(16-2)3-4-10(12)11-5-6-14-8-13(11)15/h3-4,7-8H,5-6H2,1-2H3.
What are the key properties of 7-methoxy-9-methyl-3,4-dihydropyrido[3,4-b]indole?
7-methoxy-9-methyl-3,4-dihydropyrido[3,4-b]indole has a molecular weight of 214.27 g/mol, XLogP of 2.16, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-9-methyl-3,4-dihydropyrido[3,4-b]indole is sourced from PubChem (CID 118384447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).