C15H15BrN2O3S — CID 118384496
methyl 5-amino-5-(6-bromo-2-pyridinyl)-3-oxo-5-thiophen-3-ylpentanoate (PubChem CID 118384496) has the molecular formula C15H15BrN2O3S and a molecular weight of 383.27 g/mol. Its IUPAC name is methyl 5-amino-5-(6-bromo-2-pyridinyl)-3-oxo-5-thiophen-3-ylpentanoate.
| Compound Name | methyl 5-amino-5-(6-bromo-2-pyridinyl)-3-oxo-5-thiophen-3-ylpentanoate |
|---|---|
| PubChem CID | 118384496 |
| Molecular Formula | C15H15BrN2O3S |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | methyl 5-amino-5-(6-bromo-2-pyridinyl)-3-oxo-5-thiophen-3-ylpentanoate |
| SMILES | COC(=O)CC(=O)CC(N)(c1ccsc1)c1cccc(Br)n1 |
| InChI | InChI=1S/C15H15BrN2O3S/c1-21-14(20)7-11(19)8-15(17,10-5-6-22-9-10)12-3-2-4-13(16)18-12/h2-6,9H,7-8,17H2,1H3 |
| InChIKey | MJRSKTMOTKCKJA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|