C29H23ClFN3O2S2 — CID 118384548
3-(2-chlorophenyl)sulfanyl-6-[6-(4-cyclopropyl-2-fluoroanilino)-2-pyridinyl]-6-thiophen-3-ylpiperidine-2,4-dione (PubChem CID 118384548) has the molecular formula C29H23ClFN3O2S2 and a molecular weight of 564.11 g/mol. Its IUPAC name is 3-(2-chlorophenyl)sulfanyl-6-[6-(4-cyclopropyl-2-fluoroanilino)-2-pyridinyl]-6-thiophen-3-ylpiperidine-2,4-dione.
| Compound Name | 3-(2-chlorophenyl)sulfanyl-6-[6-(4-cyclopropyl-2-fluoroanilino)-2-pyridinyl]-6-thiophen-3-ylpiperidine-2,4-dione |
|---|---|
| PubChem CID | 118384548 |
| Molecular Formula | C29H23ClFN3O2S2 |
| Molecular Weight | 564.11 g/mol |
| Exact Mass | 563.09 |
| IUPAC Name | 3-(2-chlorophenyl)sulfanyl-6-[6-(4-cyclopropyl-2-fluoroanilino)-2-pyridinyl]-6-thiophen-3-ylpiperidine-2,4-dione |
| SMILES | O=C1CC(c2ccsc2)(c2cccc(Nc3ccc(C4CC4)cc3F)n2)NC(=O)C1Sc1ccccc1Cl |
| InChI | InChI=1S/C29H23ClFN3O2S2/c30-20-4-1-2-5-24(20)38-27-23(35)15-29(34-28(27)36,19-12-13-37-16-19)25-6-3-7-26(33-25)32-22-11-10-18(14-21(22)31)17-8-9-17/h1-7,10-14,16-17,27H,8-9,15H2,(H,32,33)(H,34,36) |
| InChIKey | QWYCHHIMFDJBFK-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.11 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|