About (2-oxo-1,3-dioxolan-4-yl)methylcarbamic acid
(2-oxo-1,3-dioxolan-4-yl)methylcarbamic acid (PubChem CID 118384856) has the molecular formula C5H7NO5
and a molecular weight of 161.11 g/mol. Its IUPAC name is (2-oxo-1,3-dioxolan-4-yl)methylcarbamic acid.
Molecular Properties
| Compound Name | (2-oxo-1,3-dioxolan-4-yl)methylcarbamic acid |
| PubChem CID | 118384856 |
| Molecular Formula | C5H7NO5 |
| Molecular Weight | 161.11 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | (2-oxo-1,3-dioxolan-4-yl)methylcarbamic acid |
| SMILES | O=C(O)NCC1COC(=O)O1 |
| InChI | InChI=1S/C5H7NO5/c7-4(8)6-1-3-2-10-5(9)11-3/h3,6H,1-2H2,(H,7,8) |
| InChIKey | GNMNSBKVVBODOG-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.11 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-oxo-1,3-dioxolan-4-yl)methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-1,3-dioxolan-4-yl)methylcarbamic acid?
The IUPAC name of (2-oxo-1,3-dioxolan-4-yl)methylcarbamic acid (CID 118384856) is (2-oxo-1,3-dioxolan-4-yl)methylcarbamic acid.
What is the SMILES notation for (2-oxo-1,3-dioxolan-4-yl)methylcarbamic acid?
The canonical SMILES for (2-oxo-1,3-dioxolan-4-yl)methylcarbamic acid is O=C(O)NCC1COC(=O)O1.
What is the InChIKey of (2-oxo-1,3-dioxolan-4-yl)methylcarbamic acid?
The InChIKey is GNMNSBKVVBODOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO5/c7-4(8)6-1-3-2-10-5(9)11-3/h3,6H,1-2H2,(H,7,8).
What are the key properties of (2-oxo-1,3-dioxolan-4-yl)methylcarbamic acid?
(2-oxo-1,3-dioxolan-4-yl)methylcarbamic acid has a molecular weight of 161.11 g/mol, XLogP of -0.21, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1,3-dioxolan-4-yl)methylcarbamic acid is sourced from PubChem (CID 118384856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).